3-(Decyldimethylammonio)propanesulfonate (Sulfobetaine 10)1g
3-(Decyldimethylammonio)propanesulfonate (Sulfobetaine 10) (CAS: 15163-36-7) has the chemical formula CH3(CH2)9N(CH3)2(CH2)3SO3 and a molecular weight of 307.49 g/mol It typically appears as white solid with a purity of nan and a flash point of nan commonly used in chemical synthesis or laboratory applications.
This content will be shared across all product pages.
Internal Reference:
GEN-1147997